BenzylButylPhthalate , 10mMinDMSO , 85-68-7
Synonym(s):
BBP;CW17;mammalian branch point binding protein mBBP;mZFM;SF01
CAS NO.:85-68-7
Empirical Formula: C19H20O4
Molecular Weight: 312.36
MDL number: MFCD00009440
EINECS: 201-622-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | <-35°C |
| Boiling point: | 370°C |
| Density | 1.1 g/mL at 25 °C(lit.) |
| vapor density | 10.8 (vs air) |
| Pour Point | -45 |
| vapor pressure | 0.16 mm Hg ( 150 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | room temp |
| solubility | DMSO: 100 mg/mL (320.14 mM) |
| form | Oily Liquid |
| color | Clear |
| Specific Gravity | 1.1 |
| biological source | rabbit |
| Water Solubility | 0.000269 g/100 mL |
| FreezingPoint | -35℃ |
| BRN | 2062204 |
| Henry's Law Constant | (x 10-6 atm?m3/mol):
1.3 at 25 °C (calculated, Howard, 1989) |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | PLASTICISER |
| Cosmetic Ingredient Review (CIR) | Benzyl butyl phthalate (85-68-7) |
| InChI | 1S/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3 |
| InChIKey | IRIAEXORFWYRCZ-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCc2ccccc2 |
| LogP | 4.84 at 20℃ |
| CAS DataBase Reference | 85-68-7(CAS DataBase Reference) |
| IARC | 3 (Vol. Sup 7, 73) 1999 |
| NIST Chemistry Reference | Phthalic acid, benzyl butyl ester(85-68-7) |
| EPA Substance Registry System | Butyl benzyl phthalate (85-68-7) |
Description and Uses
Butyl benzyl phthalate is a clear, oily liquidwith a slight odor. Molecular weight = 312.39; Specificgravity (H2O:1): 1.1; Boiling point = 370; Freezing/Melting point 5 2 34.7C; Relative vapor density (air = 1):10.8; Vapor pressure = very low; Flash point =199℃;Autoignition temperature =422℃. Hazard Identification(based on NFPA-704 M Rating System): Health 1,Flammability 1, Reactivity 0. Practically insoluble in water.
Benzyl n-butyl phthalate is used as a plasticizer for vinyl foams. It is also used in floor tiles, in traffic cones, food conveyor belts and artificial leather. Further, it acts as an organic intermediate. In addition to this, it is used as a perfume fixative.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360FD-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 61-50/53-62 |
| Safety Statements | 53-45-60-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | TH9990000 |
| Autoignition Temperature | 450 °F |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173400 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
| Hazardous Substances Data | 85-68-7(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for guinea pigs 13,750 mg/kg, mice 4,170 mg/kg, rats 2,330 mg/kg (quoted, RTECS, 1985). |





