5-Bromo-2′-deoxyuridine , 10mMinDMSO , 59-14-3
Synonym(s):
brdu;5-BrdU;5-Bromo-1-(2-deoxy-β-D -ribofuranosyl)uracil;5-Bromo-2′-deoxyuridine;5-Bromouracil deoxyriboside
CAS NO.:59-14-3
Empirical Formula: C9H11BrN2O5
Molecular Weight: 307.1
MDL number: MFCD00006529
EINECS: 200-415-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 191-194 °C (dec.)(lit.) |
| alpha | 31 º (c=1, 0.1N NaOH) |
| Density | 1.8573 (rough estimate) |
| refractive index | 22 ° (C=1, H2O) |
| storage temp. | -20°C |
| solubility | NH4OH: 0.1 M at 20 °C, clear, colorless |
| pka | 7.73±0.10(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to yellow |
| Appearance | white crystals |
| biological source | synthetic (organic) |
| Water Solubility | 1-5 g/100 mL at 22 ºC |
| Merck | 14,1452 |
| BRN | 30395 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C9H11BrN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | XMJRLEURHMTTRX-UHFFFAOYSA-N |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N2C=C(Br)C(=O)NC2=O |
| LogP | -0.290 |
| CAS DataBase Reference | 59-14-3(CAS DataBase Reference) |
| EPA Substance Registry System | Uridine, 5-bromo-2'-deoxy- (59-14-3) |
Description and Uses
5-Bromo-2'-deoxyuridine is a nitrate reductase inhibitor that prevents the reduction of nitrate to nitrite by inhibiting the enzyme nitrate reductase. 5-Bromo-2'-deoxyuridine is a genotoxic agent that has been shown to cause DNA damage and cell death in vitro. 5-Bromo-2'-deoxyuridine also binds to NMDA receptors and may be useful as a model system for studying neurodegenerative diseases.
5-Bromo-2'-deoxyuridine (BrdU) is a thymidine analog used to label DNA. It is incorporated into newly synthesized DNA in place of thymidine during the S phase of the cell cycle. Cells that were actively proliferating can then be detected by denaturing the DNA and allowing specific antibodies to target the BrdU incorporation. Consequently 5-BrdU is used to study cell signaling and other processes that induce cell proliferation.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H340-H361fd |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,T |
| Risk Statements | 68-36/37/38-63-46-24-61 |
| Safety Statements | 36/37/39-26-53-45-36 |
| WGK Germany | 2 |
| RTECS | YU7350000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Muta. 1B Repr. 2 |
| Hazardous Substances Data | 59-14-3(Hazardous Substances Data) |






