A6994558
AlisolA , 10mMinDMSO , 19885-10-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB694.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-91 °C |
| Boiling point: | 629.3±55.0 °C(Predicted) |
| Density | 1.14 |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform |
| form | powder |
| pka | 14.31±0.20(Predicted) |
| color | White |
| Major Application | food and beverages |
| InChIKey | HNOSJVWYGXOFRP-UNPOXIGHSA-N |
| SMILES | O[C@@H]1[C@H]2[C@@]3([C@@H](CC[C@@]2([C@]4(CCC(=C4C1)[C@@H](C[C@H](O)[C@@H](O)C(O)(C)C)C)C)C)C(C(=O)CC3)(C)C)C |
Description and Uses
A hypocholesterolemic triterpenoid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
