A7005058
                    6,7-Dimethoxycoumarin , 10mMinDMSO , 120-08-1
                            Synonym(s):
Scoparone;6,7-Dimethylesculetin;Aesculetin dimethyl ether;Escoparone;Esculetin 6,7-dimethyl ether
                            
                        
                CAS NO.:120-08-1
Empirical Formula: C11H10O4
Molecular Weight: 206.19
MDL number: MFCD00006871
EINECS: 204-369-0
| Pack Size | Price | Stock | Quantity | 
| 1ml | RMB559.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 143-145 °C (lit.) | 
                                    
| Boiling point: | 265.04°C (rough estimate) | 
                                    
| Density | 1.0858 (rough estimate) | 
                                    
| refractive index | 1.4389 (estimate) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | >8.4mg/mL in DMSO | 
                                    
| form | Powder | 
                                    
| color | Light yellow to yellow | 
                                    
| Merck | 13,8479 | 
                                    
| InChI | InChI=1S/C11H10O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-6H,1-2H3 | 
                                    
| InChIKey | GUAFOGOEJLSQBT-UHFFFAOYSA-N | 
                                    
| SMILES | C1(=O)OC2=CC(OC)=C(OC)C=C2C=C1 | 
                                    
| LogP | 1.331 (est) | 
                                    
| CAS DataBase Reference | 120-08-1(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | 2H-1-benzopyran-2-one, 6,7-dimethoxy-(120-08-1) | 
                                    
Description and Uses
Scoparone-13C2D6 is a by-product in the synthesis of Scopoletin-13C,d3 (S200502). Scopoletin-13C,d3, is the labeled analogue of Scopoletin (S200500), used for cosmetics, topical formulations, and foods. Scoparone-13C2D6 is also the labeled form of Scoparone (S199980), which regulates the expression of Th1/Th2 cytokines and IgE and is effective in treating allergic rhinitis.
Safety
| Symbol(GHS) | ![]() GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H301-H319 | 
| Precautionary statements | P301+P310+P330-P305+P351+P338 | 
| Hazard Codes | Xn | 
| Risk Statements | 23/24/25-36-22 | 
| Safety Statements | 27/28-36/37/39-45-26 | 
| RIDADR | 2811 | 
| WGK Germany | 3 | 
| RTECS | GN6550000 | 
| HazardClass | 6.1(b) | 
| PackingGroup | III | 
| HS Code | 29322090 | 







