Dihydroethidium , 10mMinDMSO , 104821-25-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB557.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 580.4±50.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | acetonitrile: soluble |
| pka | 5.30±0.40(Predicted) |
| form | powder |
| color | Pink to dark brown |
| Appearance | Solid Powder |
| λmax | 355 nm |
| BRN | 5107482 |
| Biological Applications | Apoptosis assay; generating and detecting reactive oxygen species (ROS); detecting nucleic acids,cells; measuring respiratory burst; superoxide indicator; viability assay |
| InChI | InChI=1S/C21H21N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14/h3-13,21H,2,22-23H2,1H3 |
| InChIKey | XYJODUBPWNZLML-UHFFFAOYSA-N |
| SMILES | C1=C2C(N(CC)C(C3=CC=CC=C3)C3=C2C=CC(N)=C3)=CC(N)=C1 |
Description and Uses
Dihydroethidium is a cell-permeable blue fluorescent dye, which intercalates with nucleic acids and emits a red fluorescence detectable qualitatively by fluorescent microscopy or quantitatively by HPLC. It is a superoxide indicator. It exhibits blue fluorescence in the cytosol until oxidizedto ethidium, where it intercalates within the cell's DNA, staining its nucleus a bright fluorescent red. It is neuroprotective by reducing superoxide in mice after stroke. It has been used to detect reactive oxygen species during the phagocytic respiratory burst and for the detection of intracellular superoxide in cultured cells.
DIHYDROETHIDIUM is redox indicator. Blue fluorescence until oxidized to ethidium. Can be used for detecting superoxide radical in cells, tissues and organisms.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 29339900 |






