A7006558
Ceftiofur , 10mMinDMSO , 80370-57-6
Synonym(s):
3-[(2-Furylcarbonyl)thio]methyl]-7-[2-(2-amino-4-thiazolyl)-2-(methoxyiminoacetamido)-3-cephem-4-carboxylic acid
CAS NO.：80370-57-6
Empirical Formula: C19H17N5O7S3
Molecular Weight: 523.56
MDL number: MFCD04038020
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >212°C (dec.) |
| Density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 2.62±0.50(Predicted) |
| color | Off-White to Pale Beige |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChIKey | ZBHXIWJRIFEVQY-IHMPYVIRSA-N |
| SMILES | N12[C@@]([H])([C@H](NC(/C(/C3=CSC(N)=N3)=N\OC)=O)C1=O)SCC(CSC(C1=CC=CO1)=O)=C2C(O)=O |
Description and Uses
antifungal
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P272-P280-P284-P302+P352-P333+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| Hazardous Substances Data | 80370-57-6(Hazardous Substances Data) |
