A7007812
P-Nitrobiphenyl , 97% , 92-93-3
CAS NO.:92-93-3
Empirical Formula: C12H9NO2
Molecular Weight: 199.21
MDL number: MFCD00007342
EINECS: 202-204-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114 °C |
| Boiling point: | 340 °C |
| Density | 1.1919 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| Flash point: | 43 °C |
| solubility | Soluble in acetic acid, benzene, chloroform, and ether (Weast, 1986) |
| form | Solid |
| color | White |
| Water Solubility | insoluble |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C12H9NO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | BAJQRLZAPXASRD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 92-93-3(CAS DataBase Reference) |
| IARC | 3 (Vol. 4, Sup 7) 1987 |
| NIST Chemistry Reference | 1,1'-Biphenyl, 4-nitro-(92-93-3) |
| EPA Substance Registry System | 4-Nitrobiphenyl (92-93-3) |
Description and Uses
Formerly used as an intermediate for 4-aminobiphenyl
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H350-H411 |
| Precautionary statements | P202-P308+P313 |
| Hazard Codes | T,N |
| Risk Statements | 45-51/53 |
| Safety Statements | 53-45-61 |
| RIDADR | 2811 |
| RTECS | DV5600000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29042090 |
| Hazardous Substances Data | 92-93-3(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for rats 2,230 mg/kg, rabbits 1,970 mg/kg (quoted, RTECS, 1985). |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




