PRODUCT Properties
| Melting point: | 263°C (dec.) |
| Boiling point: | 421° |
| Density | 1.546 (estimate) |
| refractive index | 1.6560 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMF:3.0(Max Conc. mg/mL);16.03(Max Conc. mM) DMSO:10.0(Max Conc. mg/mL);53.43(Max Conc. mM) |
| form | solid |
| pka | 8.78±0.50(Predicted) |
| color | White to Amber |
| Merck | 14,410 |
| BRN | 167361 |
| InChI | InChI=1S/C5H5N3O3S/c1-3(9)7-5-6-2-4(12-5)8(10)11/h2H,1H3,(H,6,7,9) |
| InChIKey | UJRRDDHEMZLWFI-UHFFFAOYSA-N |
| SMILES | C(NC1=NC=C([N+]([O-])=O)S1)(=O)C |
| CAS DataBase Reference | 140-40-9(CAS DataBase Reference) |
Description and Uses
Nithiamide is a drug for chemotherapy. A protistocide drug with antibacterial activity.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H228-H302+H312+H332-H302-H301 |
| Precautionary statements | P301+P310a-P321-P405-P501a-P210-P240-P241-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-36/37-24/25 |
| RTECS | XJ1570000 |
| HS Code | 29341000 |
| Toxicity | chicken,LD50,oral,800mg/kg (800mg/kg),Antibiotics and Chemotherapy Vol. 5, Pg. 540, 1955. |







