A7016412
Poly(3,4-ethylenedioxythiophene)-poly(styrenesulfonate) , 1.5%inwater , 155090-83-8
Synonym(s):
1% Pedot/PSS;Orgacon DRY;Orgacon DRY5;PEDOT:PSS;Poly(2,3-dihydrothieno-1,4-dioxin)-poly(styrenesulfonate)
CAS NO.：155090-83-8
Empirical Formula: (C8H8O3S)x?x(C6H6O2S)x
Molecular Weight:
MDL number: MFCD02100138
EINECS: 629-200-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB131.20 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| Density | 1.011 g/cm3 (dried coatings) |
| refractive index | n20/D 1.344 |
| Flash point: | 100 °C |
| storage temp. | 20-25°C |
| solubility | 1.3-1.7% Solidssoluble |
| form | pellets |
| PH | 5-7 |
| Appearance | Brown to black Liquid |
| InChIKey | BBLBZBXLUSRSNO-UHFFFAOYSA-N |
| SMILES | C1C(C(CC)C)=CC=C(S(=O)(O)=O)C=1.C1C(C(CC)C)=CC=C(S(=O)(O)=O)C=1.S1C(C2SC(C)=C3OCCOC3=2)=C2OCCOC2=C1C1SC(C)=C2OCCOC=12 |
| CAS DataBase Reference | 155090-83-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, ethenyl-, homopolymer, compd. with 2,3-dihydrothieno[3,4-b]-1,4-dioxin homopolymer (155090-83-8) |
Description and Uses
AI 4083, PH 1000, HTL Solar and HTL Solar 3 for thin-film electronic fabrication
Conductive ink based on the high conductivity grade PEDOT:PSS polymer dispersion. Suitable for deposition and patterning of transparent conductive films using slot die coating and spin coating in OPV application.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | Xi,T,C,Xn |
| Risk Statements | 36/38-41-61-35-36-22-10-5 |
| Safety Statements | 26-36/37/39-36-45-53 |
| WGK Germany | 1 |
| HS Code | 39039000 |
