PRODUCT Properties
| Melting point: | 114-117 °C(lit.) |
| Boiling point: | 140℃/3mm |
| Density | 1.060±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 15mg/mL,DMSO: 10mg/mL,Ethanol: 15mg/mL,Ethanol:PBS (pH 7.2) (1:4): 0.2mg/mL |
| form | powder to crystal |
| pka | 4.78±0.32(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C12H12N2/c1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12/h3-8H,1-2H3 |
| InChIKey | PTRATZCAGVBFIQ-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=C(C)C=C2)=NC=C(C)C=C1 |
| CAS DataBase Reference | 1762-34-1(CAS DataBase Reference) |
Description and Uses
5,5'-Dimethyl-2,2'-bipyridine is widely used as an intermediate in organic synthesis and pharmaceuticals. It is also used as a raw material in the synthesis of dyestuffs and agrochemicals. It is used as a precursor for the preparation of 5-methyl-5'vinyl-2,2'-bipyridine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DW1766000 |
| HS Code | 29333990 |
| Toxicity | mouse,LD50,intraperitoneal,225mg/kg (225mg/kg),Toxicon. Vol. 23, Pg. 815, 1985. |





