A7024658
Caudatin , 10mMinDMSO , 38395-02-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 617.9±55.0 °C(Predicted) |
| Density | 1.25 |
| storage temp. | 4°C, protect from light |
| solubility | DMF:30.0(Max Conc. mg/mL);61.15(Max Conc. mM) DMSO:30.0(Max Conc. mg/mL);61.15(Max Conc. mM) Ethanol:30.0(Max Conc. mg/mL);61.15(Max Conc. mM) Ethanol:PBS (pH 7.2) (1:7):0.12(Max Conc. mg/mL);0.24(Max Conc. mM) |
| form | A solid |
| pka | 11.93±0.70(Predicted) |
| color | White to off-white |
| InChIKey | VWLXIXALPNYWFH-NLCMXFOFNA-N |
| SMILES | [C@]12(C)[C@H](OC(=O)/C=C(\C)/C(C)C)C[C@]3([H])[C@@]4(C)CC[C@H](O)CC4=CC[C@@]3(O)[C@@]1(O)CC[C@]2(O)C(C)=O |&1:0,2,13,15,19,25,27,31,r| |
Description and Uses
Gaodatin has inhibitory effect on the growth of various human-derived tumor cell lines such as human gastric cancer, colon cancer, and lung cancer.
