A7038458
cis-2,4,5-Trimethoxy-1-propenylbenzene , 10mMinDMSO , 5273-86-9
Synonym(s):
β-Asarone;cis-1-Propenyl-2,4,5-trimethoxybenzene;cis-Asarone;cis-Isoasarone
CAS NO.：5273-86-9
Empirical Formula: C12H16O3
Molecular Weight: 208.25
MDL number: MFCD00009281
EINECS: 226-096-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 296℃ |
| Density | 1.073 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Colourless to Pale Yellow |
| BRN | 1910605 |
| Stability: | Light Sensitive |
| InChI | 1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5- |
| InChIKey | RKFAZBXYICVSKP-WAYWQWQTSA-N |
| SMILES | [H]\C(C)=C(/[H])c1cc(OC)c(OC)cc1OC |
| LogP | 3.406 (est) |
| CAS DataBase Reference | 5273-86-9(CAS DataBase Reference) |
Description and Uses
Grain fumigant, insect chemisterilant.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| RTECS | DC3000000 |
| HS Code | 29093090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | cyt-hmn-lym 107 mg/L PLMEAA 53,251,87 |
