A7051958
2′-Deoxyinosine , 10mMinDMSO , 890-38-0
Synonym(s):
9-(2-Deoxy-β-D -ribofuranosyl)hypoxanthine
CAS NO.:890-38-0
Empirical Formula: C10H12N4O4
Molecular Weight: 252.23
MDL number: MFCD00005762
EINECS: 212-964-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 °C |
| alpha | 21 º (c=1, H2O 22 ºC) |
| Boiling point: | 395.4°C (rough estimate) |
| Density | 1.3402 (rough estimate) |
| refractive index | -16 ° (C=1, H2O) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| pka | 8.92±0.70(Predicted) |
| form | Powder |
| color | White to Off-white |
| biological source | synthetic (organic) |
| Water Solubility | 8.33g/L(25.02 ºC) |
| BRN | 33517 |
| InChI | InChI=1S/C10H12N4O4/c15-2-6-5(16)1-7(18-6)14-4-13-8-9(14)11-3-12-10(8)17/h3-7,15-16H,1-2H2,(H,11,12,17)/t5-,6+,7+/m0/s1 |
| InChIKey | VGONTNSXDCQUGY-RRKCRQDMSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)O)N=C2)C[C@@H]1O |
| CAS DataBase Reference | 890-38-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Inosine, 2'-deoxy-(890-38-0) |
Description and Uses
2′-Deoxyinosine has been used in the quantification of nucleoside forms of DNA lesion in a single DNA sample by liquid chromatography tandem mass spectrometry (LC-MS/MS). It has also been used as a standard for high performance liquid chromatography analysis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-37/39-36-26 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





