PRODUCT Properties
| Melting point: | 246-248°C |
| Boiling point: | 626.5±55.0 °C(Predicted) |
| Density | 1.446±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.94±0.40(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChIKey | YVCVYCSAAZQOJI-JHQYFNNDSA-N |
| SMILES | O1C2=CC3=C(C=C2OC1)[C@@H](C1=CC(OC)=C(O)C(OC)=C1)[C@@]1([H])C(=O)OC[C@]1([H])[C@@H]3O |
Description and Uses
A potent inhibitor of microtubule assembly.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H350-H360 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1A Repr. 1A |







