A7053258
Ac-DEVD-CHO,N-Acetyl-Asp-Glu-Val-Asp-al , 10mMinWater , 169332-60-9
Synonym(s):
Ac-DEVD-CHO;Caspase-3 Inhibitor I - CAS 169332-60-9 - Calbiochem;CPP32/Apopain Inhibitor, Ac-DEVD-CHO
CAS NO.:169332-60-9
Empirical Formula: C20H30N4O11
Molecular Weight: 502.47
MDL number: MFCD00671412
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 1021.1±65.0 °C(Predicted) |
| Density | 1.374±0.06 g/cm3(Predicted) |
| RTECS | EK7643000 |
| storage temp. | -20°C |
| solubility | H2O: 1 mg/mL |
| form | powder |
| pka | 4.19±0.10(Predicted) |
| color | white |
| biological source | synthetic |
| Water Solubility | H2O: 1mg/mL |
| Sensitive | Moisture Sensitive |
| Sequence | N-Acetyl-Asp-Glu-Val-Asp-al |
| InChIKey | UMBVAPCONCILTL-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C(CC(O)=O)NC(=O)C(NC(=O)C(CCC(O)=O)NC(=O)C(CC(O)=O)NC(C)=O)C(C)C |
Description and Uses
Reversible inhibitor of interleukin-1beta converting enzyme (ICE); also inhibits caspase-3 cleavage of poly(ADP-ribose) polymerase
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






