PRODUCT Properties
| Melting point: | 216-218 °C (lit.) |
| Boiling point: | 194.6°C (rough estimate) |
| Density | 1.1118 (rough estimate) |
| refractive index | 1.5340 (estimate) |
| Flash point: | 240 °C |
| storage temp. | Store below +30°C. |
| solubility | 30g/l |
| pka | 9.17±0.12(Predicted) |
| form | Crystalline Powder |
| color | Brownish to brown-gray |
| Water Solubility | 24 g/L (20 ºC) |
| Merck | 14,2986 |
| BRN | 110232 |
| InChI | InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8) |
| InChIKey | OYTKINVCDFNREN-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(N)=C1N |
| CAS DataBase Reference | 54-96-6(CAS DataBase Reference) |
Description and Uses
It is a potassium channel blocker in nerve terminals. It inhibits potassium channel efflux, increasing the duration of the action potential, which results in an increase in the duration of calcium channel opening and enhanced acetylcholine (ACh) release. Increased ACh availability at the motor end plate allows muscles to contract.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330-H311-H319 |
| Precautionary statements | P260-P264-P280-P302+P352+P312-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,T,Xi |
| Risk Statements | 25-26-36/37/38 |
| Safety Statements | 26-28-36/37/39-45-37/39-28A-36 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | US7600000 |
| F | 10-23 |
| Autoignition Temperature | 480 °C |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29333999 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral Acute Tox. 3 Dermal Eye Irrit. 2 |
| Toxicity | LD50 orally in Rabbit: 47 mg/kg LD50 dermal Rabbit > 200 mg/kg |
| Limited Quantities | 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |





