A7054358
Cyproheptadinehydrochloridesesquihydrate , 10mMinDMSO , 41354-29-4
Synonym(s):
4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-methyl-piperidine hydrochloride hydrate;Cyproheptadine hydrochloride sesquihydrate;Piperidine, 4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-methyl-, hydrochloride, hydrate (2:3)
CAS NO.:41354-29-4
Empirical Formula: C21H24ClNO
Molecular Weight: 341.88
MDL number: MFCD27967225
EINECS: 623-762-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ethanol: soluble |
| form | solid |
| color | white to slightly yellow |
| λmax | 285nm(0.05mol/L H2SO4)(lit.) |
| Merck | 14,2773 |
| InChI | InChI=1S/C21H21N.ClH.H2O/c1-22-14-12-18(13-15-22)21-19-8-4-2-6-16(19)10-11-17-7-3-5-9-20(17)21;;/h2-11H,12-15H2,1H3;1H;1H2 |
| InChIKey | PFQPCBUPUOPHGM-UHFFFAOYSA-N |
| SMILES | CN1CCC(=C2C3C=CC=CC=3C=CC3=CC=CC=C23)CC1.Cl.O |
| CAS DataBase Reference | 41354-29-4(CAS DataBase Reference) |
Description and Uses
Structural studies of an antihistimine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TM7050000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orally in mice: 74.2 mg/kg (Loux) |





