PRODUCT Properties
| Melting point: | 165-166℃ (dec.) |
| alpha | D20 +107.0° (c = 1.9 in CHCl3); D20 +103.5° (c = 1.0 in CHCl3) |
| Boiling point: | 700.6±60.0 °C(Predicted) |
| Density | 1.29±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| pka | 14.66±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | insoluble in water |
| Stability: | Light Sensitive, Unstable in Acidic Condition |
| InChIKey | PZHWYURJZAPXAN-ILOFNVQHSA-N |
| SMILES | O1[C@@H]2[C@@]43[C@@H]([C@@H]([C@H]5[C@@H]4C(=C6[C@H]7OC(=O)[C@H]([C@@H]7CC[C@@]([C@@H]65)(O)C)C)C)C=C3C)[C@](CC[C@H]2[C@@H](C1=O)C)(O)C |
Description and Uses
Absinthin is an extract from the bitter liquor Absinthe, which owes its taste to substances found in the wormwood plant used in its formulation. Absinthin contributes to this bitter taste through action upon the hTAS2R14 bitter taste receptor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |







