PRODUCT Properties
| Melting point: | 261~264℃ |
| Boiling point: | 588.8±50.0 °C(Predicted) |
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: Soluble Methanol: Soluble |
| form | powder |
| pka | 6.12±0.40(Predicted) |
| color | Yellow |
| Water Solubility | Slightly soluble in water |
| Major Application | food and beverages |
| InChI | InChI=1S/C20H20O8/c1-23-11-7-6-10(8-12(11)24-2)18-20(27-5)17(22)15-13(28-18)9-14(25-3)19(26-4)16(15)21/h6-9,21H,1-5H3 |
| InChIKey | RIGYMJVFEJNCKD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC)C(OC)=C2)OC2=CC(OC)=C(OC)C(O)=C2C(=O)C=1OC |
| LogP | 2.550 (est) |
Description and Uses
Artemitin has an anti-tumor, anti-inflammatory, antibacterial, blood pressure lowering effects.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |







