A7080358
2-Chloro-4-nitrobenzamide , 10mMinDMSO , 3011-89-0
Synonym(s):
2-Chloro-4-nitrobenzamide
CAS NO.:3011-89-0
Empirical Formula: C7H5ClN2O3
Molecular Weight: 200.58
MDL number: MFCD00017119
EINECS: 221-143-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173°C |
| Boiling point: | 335.8±32.0 °C(Predicted) |
| Density | 1.520±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: 250 mg/mL (1246.39 mM) |
| form | Solid |
| pka | 14.39±0.50(Predicted) |
| color | White to Light yellow |
| BRN | 1966537 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C7H5ClN2O3/c8-6-3-4(10(12)13)1-2-5(6)7(9)11/h1-3H,(H2,9,11) |
| InChIKey | GFGSZUNNBQXGMK-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 3011-89-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloro-4-nitrobenzamide (3011-89-0) |
Description and Uses
antineoplastic, antimetabolite
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H301 |
| Precautionary statements | P280a-P301+P310a-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







