A7092858
Diatrizoicacid , 10mMinDMSO , 117-96-4
Synonym(s):
Amidotrizoic Acid;Diatrizoic acid;NSC 262168
CAS NO.:117-96-4
Empirical Formula: C11H9I3N2O4
Molecular Weight: 613.91
MDL number: MFCD00069960
EINECS: 204-223-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 614.1±55.0 °C(Predicted) |
| Density | 2.4079 (estimate) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in Methanol. |
| pka | 0.92±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 500g/L(25 ºC) |
| Merck | 14,2992 |
| Stability: | Light Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C11H9I3N2O4/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18/h1-2H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | YVPYQUNUQOZFHG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(I)C(NC(C)=O)=C(I)C(NC(C)=O)=C1I |
| LogP | 3.3 at 20℃ |
| EPA Substance Registry System | Benzoic acid, 3,5-bis(acetylamino)-2,4,6-triiodo- (117-96-4) |
Description and Uses
radiopaque agent
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H334-H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P261-P285-P304+P341-P342+P311-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | DG5950000 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 117-96-4(Hazardous Substances Data) |
| Toxicity | LD50 intravenous in mouse: 8900mg/kg |







