A7095312
Quintozene , Analysis standard product, 99% , 82-68-8
Synonym(s):
PCNB;Pentachloronitrobenzene;Quintozene
CAS NO.:82-68-8
Empirical Formula: C6Cl5NO2
Molecular Weight: 295.33
MDL number: MFCD00007065
EINECS: 201-435-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-143 °C (lit.) |
| Boiling point: | 328°C |
| Density | 1.718 |
| vapor pressure | 1.27 x l0-2Pa (25 °C) |
| Flash point: | 11 °C |
| storage temp. | APPROX 4°C |
| solubility | toluene: soluble50mg/mL, clear, faintly to slightly yellow |
| form | powder |
| color | yellow to tan |
| Water Solubility | Insoluble |
| Merck | 8080 |
| BRN | 1914324 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/C6Cl5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| InChIKey | LKPLKUMXSAEKID-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS DataBase Reference | 82-68-8(CAS DataBase Reference) |
| IARC | 3 (Vol. 5, Sup 7) 1987 |
| NIST Chemistry Reference | Benzene, pentachloronitro-(82-68-8) |
| EPA Substance Registry System | Pentachloronitrobenzene (82-68-8) |
Description and Uses
Pentachloronitrobenzene (PCNB) is a pesticide and fungicide. Sensitization can occur in farmers and in those working in chemical plants.
Pentachloronitrobenzene (PCNB) is used as a fungicide to suppress the growth of fungi in selective culture media such as Nash and Snyder medium (NS).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N,T,F,Xn |
| Risk Statements | 43-50/53-39/23/24/25-23/24/25-11-40-51/53 |
| Safety Statements | 13-24-37-60-61-45-36/37-16-24/25-23 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DA6650000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 82-68-8(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (g/kg): 1.71 ±0.20, 1.65 ±0.17 by gavage (Finnegan) |





