A7971612
2,4,6-Trichloronitrobenzene , >96.0%(GC) , 18708-70-8
CAS NO.:18708-70-8
Empirical Formula: C6H2Cl3NO2
Molecular Weight: 226.44
MDL number: MFCD00014690
EINECS: 242-518-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB104.80 | In Stock |
|
| 25G | RMB453.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-72 °C |
| Boiling point: | 303.2±37.0 °C(Predicted) |
| Density | 1.651±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | methanol: 0.1 g/mL, clear |
| form | Solid |
| color | White to Pale Yellow |
| BRN | 2213282 |
| Stability: | Stable. Incompatible with strong bases, strong reducing agents, strong oxidizing agents. |
| InChI | 1S/C6H2Cl3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| InChIKey | AEBJDOTVYMITIA-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1c(Cl)cc(Cl)cc1Cl |
| CAS DataBase Reference | 18708-70-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,6-Trichloronitrobenzene (18708-70-8) |
Description and Uses
1,3,5-Trichloro-2-nitrobenzene is a building block for organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H373-H413 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-33 |
| Safety Statements | 28-36/37/39-45 |
| RIDADR | UN 1578 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2904.99.4700 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 4 STOT RE 2 |





