A7095458
D-Glucuronicacid , 10mMinDMSO , 6556-12-3
Synonym(s):
D -Glucuronic acid;Glucosiduronic acid
CAS NO.:6556-12-3
Empirical Formula: C6H10O7
Molecular Weight: 194.14
MDL number: MFCD00077778
EINECS: 229-486-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161 °C (lit.) |
| alpha | [α]D20 +35.0~+39.0゜(c=6,H2O) |
| Boiling point: | 250.56°C (rough estimate) |
| Density | 1.4301 (rough estimate) |
| refractive index | 36 ° (C=6, H2O) |
| storage temp. | -20°C |
| solubility | H2O: soluble100mg/mL, clear to slightly hazy |
| pka | pKa 3.18(H2O
t=20.0) (Uncertain) |
| form | Crystalline Powder |
| color | White to off-white |
| biological source | synthetic (organic) |
| optical activity | +11.7 → +36.3 |
| Water Solubility | Soluble in water. |
| Merck | 14,4465 |
| BRN | 1727083 |
| Stability: | Hygroscopic |
| InChI | 1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6+/m0/s1 |
| InChIKey | LCUVNMXNGSEBHT-RJOKPDHXSA-N |
| SMILES | O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O |
| CAS DataBase Reference | 6556-12-3(CAS DataBase Reference) |
| EPA Substance Registry System | D-Glucuronic acid (6556-12-3) |
Description and Uses
Glucuronic acid (from Ancient Greek γλυκ "sweet" + ορον "urine") is a carboxylic acid. Its structure is similar to that of glucose. However, glucuronic acid's sixth carbon is oxidized to a carboxylic acid. Its formula is C6H10O7. The salts and esters of glucuronic acid are known as glucuronates; the anion C6H9O7-is the glucuronate ion.
D-Glucuronic acid is used as pharmaceutical intermediate and in chemical research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| RTECS | LZ8836600 |
| TSCA | TSCA listed |
| HS Code | 2932 99 00 |
| Storage Class | 11 - Combustible Solids |






