A7098412
2,6-Dihydroxyquinoline , 94% , 19315-93-6
Synonym(s):
2,6-Dihydroxyquinoline;6-Hydroxycarbostyril
CAS NO.：19315-93-6
Empirical Formula: C9H7NO2
Molecular Weight: 161.16
MDL number: MFCD03840564
EINECS: 626-682-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB312.80 | In Stock |
|
| 100G | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C(lit.) |
| Boiling point: | 449.4±45.0 °C(Predicted) |
| Density | 1.337±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.61±0.20(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C9H7NO2/c11-7-2-3-8-6(5-7)1-4-9(12)10-8/h1-5,11H,(H,10,12) |
| InChIKey | AQLYZDRHNHZHIS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(O)C=C2)C=CC1=O |
| CAS DataBase Reference | 19315-93-6(CAS DataBase Reference) |
Description and Uses
Reactant involved in synthesis of:
- (Benzyloxy)methylquinolinone derivatives for use as PDE3 inhibitors
- Substances related to cilostazol
- 2,6-Quinolinyl derivatives for use as VLA-4 / VCAM-1 antagonists
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | VC4130000 |
| F | 8 |
| HS Code | 29334900 |
