A7099212
3-Quinolineboronic acid pinacol ester , 95% , 171364-85-5
Synonym(s):
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline
| Pack Size | Price | Stock | Quantity |
| 1G | RMB125.60 | In Stock |
|
| 5G | RMB368.80 | In Stock |
|
| 25g | RMB1532.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-60 °C(lit.) |
| Boiling point: | 386.5±15.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 5.12±0.12(Predicted) |
| form | Powder or Solid |
| color | White to pale brown |
| InChI | 1S/C15H18BNO2/c1-14(2)15(3,4)19-16(18-14)12-9-11-7-5-6-8-13(11)17-10-12/h5-10H,1-4H3 |
| InChIKey | ARRJAONCYUAPJR-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2cnc3ccccc3c2 |
Description and Uses
3-Quinolineboronic Acid Pinacol Ester is used as a reagent in the synthesis of 11-(pyridinylphenyl)steroids which is a novel class of mixed progesterone agonists / antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
