A7102712
6-Quinolinecarboxylic Acid , >98.0%(HPLC) , 10349-57-2
CAS NO.:10349-57-2
Empirical Formula: C10H7NO2
Molecular Weight: 173.17
MDL number: MFCD00047613
EINECS: 233-761-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB92.80 | In Stock |
|
| 25G | RMB347.20 | In Stock |
|
| 100G | RMB1052.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 293-294 °C |
| Boiling point: | 303.81°C (rough estimate) |
| Density | 1.2427 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Practically insoluble in water |
| form | Crystalline Powder |
| pka | 3.05±0.30(Predicted) |
| color | Beige to brown |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9/h1-6H,(H,12,13) |
| InChIKey | VXGYRCVTBHVXMZ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(C(O)=O)=CC=2)C=CC=1 |
| CAS DataBase Reference | 10349-57-2(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Quinolinecarboxylic acid (10349-57-2) |
Description and Uses
6-Quinolinecarboxylic acid is a vital compound and can be used to synthesise 6-Quinolinecarboxaldehyde, 6-(Aminomethyl)quinoline, and Quinolin-6-ylmethanol, etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29334900 |






