PRODUCT Properties
| Melting point: | 95-98?C |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Very soluble in water, freely soluble in ethanol (96 per cent). |
| form | Solid |
| color | White to Off-White |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents, acids, bases. |
| InChI | InChI=1S/C17H22N2O.C4H6O4/c1-17(20-14-13-19(2)3,15-9-5-4-6-10-15)16-11-7-8-12-18-16;5-3(6)1-2-4(7)8/h4-12H,13-14H2,1-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | KBAUFVUYFNWQFM-UHFFFAOYSA-N |
| SMILES | C(C)(OCCN(C)C)(C1=NC=CC=C1)C1C=CC=CC=1.C(C(=O)O)CC(=O)O |
| LogP | 2.519 (est) |
| CAS DataBase Reference | 562-10-7(CAS DataBase Reference) |
| IARC | 3 (Vol. 79) 2001 |
| EPA Substance Registry System | Doxylamine succinate (1:1) (562-10-7) |
Description and Uses
Doxylamine succinate salt has been used as a therapeutic drug to check developmental toxicity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| target organs | Respiratory system |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-36/37/38-20/21/22-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36/37-45-16-7 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 2 |
| RTECS | US9275000 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral STOT SE 3 |
| Toxicity | LD50 in mice, rabbits (mg/kg): 470, 250 orally; 62, 49 i.v.; in mice, male rats, female rats (mg/kg): 460, 440, 445 s.c. (Brown, Werner) |



