A7099912
Quinoline-5-boronic Acid(contains varying amounts of Anhydride) , 97% , 355386-94-6
CAS NO.：355386-94-6
Empirical Formula: C9H8BNO2
Molecular Weight: 172.98
MDL number: MFCD03095058
EINECS: 670-357-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB80.00 | In Stock |
|
| 1G | RMB296.80 | In Stock |
|
| 5G | RMB779.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-148°C |
| Boiling point: | 400.3±37.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.46±0.30(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C9H8BNO2/c12-10(13)8-4-1-5-9-7(8)3-2-6-11-9/h1-6,12-13H |
| InChIKey | NWIJBOCPTGHGIK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC2N=CC=CC1=2)(O)O |
| CAS DataBase Reference | 355386-94-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-36-37/39-37 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
