A7100612
                    3-Quinolineboronic acid , 95% , 191162-39-7
                            Synonym(s):
(3-Quinolinyl)boronic acid;(3-Quinolyl)boronic acid;Quinolin-3-ylboronic acid
                            
                        
                CAS NO.:191162-39-7
Empirical Formula: C9H8BNO2
Molecular Weight: 172.98
MDL number: MFCD02183527
EINECS: 640-162-5
| Pack Size | Price | Stock | Quantity | 
| 250mg | RMB23.20 | In Stock | 
                                                 | 
                                        
| 1G | RMB38.40 | In Stock | 
                                                 | 
                                        
| 5G | RMB112.80 | In Stock | 
                                                 | 
                                        
| 25G | RMB430.40 | In Stock | 
                                                 | 
                                        
| 100G | RMB1236.80 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 148-155°C | 
                                    
| Boiling point: | 400.3±37.0 °C(Predicted) | 
                                    
| Density | 1.28±0.1 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | DMSO (Slightly), Methanol (Slightly) | 
                                    
| pka | 4.61±0.30(Predicted) | 
                                    
| form | Powder | 
                                    
| color | Light pink or orange to light brown | 
                                    
| BRN | 8764547 | 
                                    
| InChI | InChI=1S/C9H8BNO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-6,12-13H | 
                                    
| InChIKey | YGDICLRMNDWZAK-UHFFFAOYSA-N | 
                                    
| SMILES | N1C2C(=CC=CC=2)C=C(B(O)O)C=1 | 
                                    
| CAS DataBase Reference | 191162-39-7(CAS DataBase Reference) | 
                                    
Description and Uses
May contain varying amounts of anhydride.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 | 
| Hazard Codes | Xn,Xi | 
| Risk Statements | 36/37/38-22 | 
| Safety Statements | 36/37/39-26-22-37-36 | 
| WGK Germany | 3 | 
| Hazard Note | Irritant | 
| HazardClass | IRRITANT, KEEP COLD | 
| HS Code | 29334900 | 







