A7093712
3-Quinolinecarboxylic acid , 98% , 6480-68-8
CAS NO.:6480-68-8
Empirical Formula: C10H7NO2
Molecular Weight: 173.17
MDL number: MFCD00006770
EINECS: 229-337-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB92.80 | In Stock |
|
| 25G | RMB422.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 277-280 °C (lit.) |
| Boiling point: | 303.81°C (rough estimate) |
| Density | 1.2427 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.20±0.30(Predicted) |
| form | Powder |
| color | White to slightly beige |
| BRN | 126542 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-6H,(H,12,13) |
| InChIKey | DJXNJVFEFSWHLY-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=C(C(O)=O)C=1 |
| CAS DataBase Reference | 6480-68-8(CAS DataBase Reference) |
Description and Uses
A quinoline derivative with antimicrobial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 22-24/25-37/39-26-37 |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |






