A7094312
8-Quinolinesulfonyl chloride , 98% , 18704-37-5
CAS NO.：18704-37-5
Empirical Formula: C9H6ClNO2S
Molecular Weight: 227.67
MDL number: MFCD00006808
EINECS: 242-515-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB417.60 | In Stock |
|
| 100G | RMB1544.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-129 °C(lit.) |
| Boiling point: | 306°C |
| Density | 1.483±0.06 g/cm3(Predicted) |
| Flash point: | 306°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | methanol: soluble10mg/mL, clear, colorless to light yellow |
| pka | 0?+-.0.17(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Moisture Sensitive |
| BRN | 156347 |
| InChI | InChI=1S/C9H6ClNO2S/c10-14(12,13)8-5-1-3-7-4-2-6-11-9(7)8/h1-6H |
| InChIKey | JUYUYCIJACTHMK-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2S(Cl)(=O)=O)C=CC=1 |
| CAS DataBase Reference | 18704-37-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Sulfonyl chloride, 8-quinoline-(18704-37-5) |
Description and Uses
8-Quinolinesulfonyl chloride was used as a coupling reagent in oligonucleotide synthesis. It was also used in the synthesis of olefins from secondary esters at moderate temperature
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | VC2830000 |
| F | 3-10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29334990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
