PRODUCT Properties
| Melting point: | 231-232° (U.S. patent); mp 238-239° (P'an) |
| Boiling point: | 680.6±65.0 °C(Predicted) |
| Density | 1.4176 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.57±0.20(Predicted) |
| color | White to Off-White |
| Water Solubility | 2.8mg/L(room temperature) |
| InChI | 1S/C15H14ClN3O4S3/c16-11-6-12-14(7-13(11)25(17,20)21)26(22,23)19-15(18-12)9-24-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,18,19)(H2,17,20,21) |
| InChIKey | NDTSRXAMMQDVSW-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc2c(NC(CSCc3ccccc3)=NS2(=O)=O)cc1Cl |
| EPA Substance Registry System | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3-[[(phenylmethyl)thio]methyl]-, 1,1-dioxide (91-33-8) |
Description and Uses
Benzthiazide is a diuretic, antihypertensive agent.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P280-P342+P311 |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | DK8400000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| Hazardous Substances Data | 91-33-8(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): >5000, >10000 orally; 410, 422 i.v. (P'an) |





