A7122712
(R)-(-)-3-Amino-1-Boc-piperidine , 98% , 188111-79-7
Synonym(s):
(R)-1-Boc-3-piperidinamine;tert-Butyl (R)-3-amino-1-piperidinecarboxylate
CAS NO.:188111-79-7
Empirical Formula: C10H20N2O2
Molecular Weight: 200.28
MDL number: MFCD03094717
EINECS: 628-472-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25g | RMB236.00 | In Stock |
|
| 100g | RMB908.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 28.5 º (c=1, DMF) |
| Boiling point: | 277.3±33.0 °C(Predicted) |
| Density | 1.041±0.06 g/cm3(Predicted) |
| refractive index | 1.4730 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMF (Slightly), DMSO (Slightly) |
| pka | 10.35±0.20(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow |
| optical activity | [α]/D -28.5±2°, c = 1 in DMF |
| Water Solubility | Immiscible with water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7,11H2,1-3H3/t8-/m1/s1 |
| InChIKey | AKQXKEBCONUWCL-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](N)C1 |
| CAS DataBase Reference | 188111-79-7(CAS DataBase Reference) |
Description and Uses
(R)-3-Amino-1-Boc-piperidine can be used to prepare a benzoxazepine derivative named (R)-7-(3,5-dimethoxyphenyl)-N-(piperidin-3-yl)-4-propionyl-2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxamide, a potent CBP/P300 bromodomain inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN2735 |
| WGK Germany | 3 |
| F | 10-34 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |






