A7132812
Rebamipide , ≥98% , 90098-04-7
Synonym(s):
α-[(4-Chlorobenzoyl)amino]-1,2-dihydro-2-oxo-4-quinolinepropanoic acid hydrate;Mucosta hydrate;OPC 12759 hydrate;Proamipide hydrate
CAS NO.:90098-04-7
Empirical Formula: C19H15ClN2O4
Molecular Weight: 370.79
MDL number: MFCD00866895
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB50.40 | In Stock |
|
| 10g | RMB89.60 | In Stock |
|
| 25G | RMB176.80 | In Stock |
|
| 100g | RMB592.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 288-290°C dec. |
| Boiling point: | 695.0±55.0 °C(Predicted) |
| Density | 1.394±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: >5mg/mL |
| pka | 3.38±0.10(Predicted) |
| form | powder |
| color | white |
| Merck | 14,8124 |
| InChI | InChI=1S/C19H15ClN2O4/c20-13-7-5-11(6-8-13)18(24)22-16(19(25)26)9-12-10-17(23)21-15-4-2-1-3-14(12)15/h1-8,10,16H,9H2,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | ALLWOAVDORUJLA-UHFFFAOYSA-N |
| SMILES | C(C1=CC(=O)NC2=CC=CC=C12)C(C(=O)O)NC(C1C=CC(Cl)=CC=1)=O |
| CAS DataBase Reference | 90098-04-7(CAS DataBase Reference) |
Description and Uses
An inducer of endogenous prostaglandin and a oxygen-derived free radical scavenger.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type N95 (US) |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| RTECS | VC2518500 |
| HS Code | 29337900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |







