A7138412
trans-2-Phenylcyclopropylamine hydrochloride , 97% , 1986-47-6
Synonym(s):
(±)-trans-2-Phenylcyclopropylamine;Tranylcypromine;Tranylcypromine, HCl - CAS 1986-47-6 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB88.00 | In Stock |
|
| 1G | RMB278.40 | In Stock |
|
| 5G | RMB1123.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-169 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Powder or Chunks |
| color | White to light beige |
| biological source | synthetic (organic) |
| optical activity | [α]/D 1 to +1.0°, c = 1 in H2O |
| Stability: | Hygroscopic |
| InChI | InChI=1/C9H11N.ClH/c10-9-6-8(9)7-4-2-1-3-5-7;/h1-5,8-9H,6,10H2;1H/t8-,9+;/s3 |
| InChIKey | ZPEFMSTTZXJOTM-HLRUTPIHNA-N |
| SMILES | N[C@@H]1C[C@H]1C1C=CC=CC=1.Cl |&1:1,3,r| |
Description and Uses
Antidepressant;MAO inhibitor
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T,Xn |
| Risk Statements | 36/37/38-25-20/21-52-22 |
| Safety Statements | 45-36/37/39-26 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






