BD7837731
trans-2-Phenylcyclopropanecarboxylic acid , 97% , 939-90-2
CAS NO.:939-90-2
Empirical Formula: C10H10O2
Molecular Weight: 162.19
MDL number: MFCD00001292
EINECS: 213-366-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB152.80 | In Stock |
|
| 25g | RMB753.60 | In Stock |
|
| 100g | RMB2741.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88 °C(lit.) |
| Boiling point: | 248.88°C (rough estimate) |
| Density | 1.0613 (rough estimate) |
| refractive index | 1.5782 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane, Ethanol |
| pka | 4.57±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow or beige |
| BRN | 3197783 |
| InChI | 1S/C10H10O2/c11-10(12)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,11,12)/t8-,9+/m0/s1 |
| InChIKey | AHDDRJBFJBDEPW-DTWKUNHWSA-N |
| SMILES | OC(=O)[C@@H]1C[C@H]1c2ccccc2 |
| CAS DataBase Reference | 939-90-2(CAS DataBase Reference) |
Description and Uses
Intermediate in the production of 2C receptor agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |







