BD4800841
trans-2,6-Dimethylmorpholine , 95% , 6485-45-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB176.80 | In Stock |
|
| 250mg | RMB324.80 | In Stock |
|
| 1g | RMB740.00 | In Stock |
|
| 5g | RMB2230.40 | In Stock |
|
| 10g | RMB3829.60 | In Stock |
|
| 25g | RMB7691.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 146.6±0.0 °C(Predicted) |
| Density | 0.862±0.06 g/cm3(Predicted) |
| vapor pressure | 1.71-3.88hPa at 10.9-22.5℃ |
| storage temp. | 2-8°C(protect from light) |
| solubility | Chloroform (Slightly), Water (Slightly) |
| pka | 9.04±0.60(Predicted) |
| form | Oil |
| color | Clear Colorless to Pale Yellow |
| InChI | InChI=1/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3/t5-,6-/s3 |
| InChIKey | HNVIQLPOGUDBSU-FJGCHTOXNA-N |
| SMILES | N1C[C@@H](C)O[C@H](C)C1 |&1:2,5,r| |
| LogP | -0.15 at 25℃ |
Description and Uses
trans-2,6-Dimethylmorpholine is used as a reagent in the synthesis of 4-Amino-5-chloro-2-methoxybenzoates as agonists and antagonists for 5-HT4 receptors. Also a reagent in the synthesis of trans-Amorolfine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405 |
| RIDADR | 1992 |
| PackingGroup | Ⅲ |
| HS Code | 2934999090 |
