A7141012
(R)-3-Hydroxyisobutyric Acid Methyl Ester , ≥98.0%(GC) , 72657-23-9
Synonym(s):
(−)-Methyl D -β-hydroxyisobutyrate;(R)-(−)-3-Hydroxy-2-methylpropionic acid methyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB224.00 | In Stock |
|
| 5G | RMB674.40 | In Stock |
|
| 25G | RMB2531.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 76-77 °C12 mm Hg(lit.) |
| Density | 1.066 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 178 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 14.40±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless |
| optical activity | [α]19/D −26°, c = 4 in methanol |
| BRN | 3587507 |
| InChI | InChI=1S/C5H10O3/c1-4(3-6)5(7)8-2/h4,6H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | ATCCIZURPPEVIZ-SCSAIBSYSA-N |
| SMILES | C(OC)(=O)[C@H](C)CO |
| CAS DataBase Reference | 72657-23-9(CAS DataBase Reference) |
Description and Uses
The (R)- and (S)-isomers are bifunctional building blocks for the synthesis of a wide variety of optically active molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 16 |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 3 - Flammable liquids |
