A8355912
Triethyl 1,1,2-ethanetricarboxylate , 98% , 7459-46-3
CAS NO.:7459-46-3
Empirical Formula: C11H18O6
Molecular Weight: 246.26
MDL number: MFCD00009154
EINECS: 231-235-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB180.00 | In Stock |
|
| 100G | RMB647.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 99 °C/0.5 mmHg (lit.) |
| Density | 1.074 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| pka | 11.78±0.59(Predicted) |
| form | Liquid |
| Specific Gravity | 1.074 |
| color | Clear colorless |
| BRN | 1796294 |
| Dielectric constant | 6.5(19.0℃) |
| InChI | InChI=1S/C11H18O6/c1-4-15-9(12)7-8(10(13)16-5-2)11(14)17-6-3/h8H,4-7H2,1-3H3 |
| InChIKey | TVWZLLYAJDSSCJ-UHFFFAOYSA-N |
| SMILES | C(C(=O)OCC)(C(=O)OCC)CC(=O)OCC |
| CAS DataBase Reference | 7459-46-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1,2-Ethanetricarboxylic acid, triethyl ester(7459-46-3) |
Description and Uses
Triethyl 1,1,2-ethanetricarboxylate is a carboxylic acid ester compound that can be used in nanomaterials, pharmaceutical intermediates, organic synthesis and other fields.
1,1,2-Ethanetricarboxylic Acid 1,1,2-Triethyl Ester is a useful synthetic intermediate. It can be used to prepare Isobutylsuccinic Acid (I780660) which was used to synthesize succinimide derivatives as inhibitors of human leukocyte elastase, cathepsin G and proteinase 3.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS02 |
| Signal word | Danger |
| Hazard statements | H301-H226 |
| Precautionary statements | P501-P270-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P303+P361+P353-P301+P310+P330-P403+P235-P405 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 29420000 |
| Storage Class | 10 - Combustible liquids |






