A7144312
(R)-(-)-2-Amino-1-phenylethanol , ≥97%,ee98% , 2549-14-6
Synonym(s):
(R)-α-(Aminomethyl)benzyl alcohol
CAS NO.:2549-14-6
Empirical Formula: C8H11NO
Molecular Weight: 137.18
MDL number: MFCD00239406
EINECS: 626-292-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB293.60 | In Stock |
|
| 5G | RMB1119.20 | In Stock |
|
| 25g | RMB3919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-65 °C(lit.) |
| Boiling point: | 160°C/17mm |
| alpha | -43 º (c=2%, EtOH) |
| Density | 1.104±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, protect from light |
| pka | 12.04±0.35(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| optical activity | [α]22/D 39°, c = 2 in ethanol |
| Sensitive | Air Sensitive |
| BRN | 3196196 |
| InChI | InChI=1/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2/t8-/s3 |
| InChIKey | ULSIYEODSMZIPX-SBYBRXNCNA-N |
| SMILES | C1(=CC=CC=C1)[C@@H](O)CN |&1:6,r| |
| CAS DataBase Reference | 2549-14-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H318-H302-H314 |
| Precautionary statements | P303+P361+P353-P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 3 |
| WGK Germany | 3 |
| F | 3-10-23-34 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29062990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





