A7145212
(R)-(−)-O-Acetylmandelic acid , ≥98.0%(GC) , 51019-43-3
Synonym(s):
(−)-O-Acetyl-D -mandelic acid;(R)-(−)-α-Acetoxyphenylacetic acid
CAS NO.:51019-43-3
Empirical Formula: C10H10O4
Molecular Weight: 194.19
MDL number: MFCD00004249
EINECS: 610-598-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB54.40 | In Stock |
|
| 1G | RMB143.20 | In Stock |
|
| 100g | RMB171.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-99 °C(lit.) |
| Boiling point: | 317.8±30.0 °C(Predicted) |
| Density | 1.259±0.06 g/cm3(Predicted) |
| refractive index | -153 ° (C=2, Acetone) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in methanol. (almost transparency) |
| pka | 2.76±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 152.4°, c = 2 in acetone |
| BRN | 2694110 |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | InChI=1/C10H10O4/c1-7(11)14-9(10(12)13)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,12,13)/t9-/s3 |
| InChIKey | YCCSWLJUVZBEAS-SECBINFHSA-N |
| SMILES | [C@@H](C1C=CC=CC=1)(C(=O)O)OC(=O)C |&1:0,r| |
| LogP | 1.780 (est) |
| CAS DataBase Reference | 51019-43-3(CAS DataBase Reference) |
Description and Uses
(R)-(-)-O-Acetylmandelic acid may be used as a precursor to prepare a chiral diamine, which is an intermediate to prepare Utenone A. It may also be used to prepare ethyl (2′R)-2′-acetoxy-2′-phenylethanoate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-60-37-26 |
| WGK Germany | 3 |
| HS Code | 29181990 |






