PRODUCT Properties
| Melting point: | 50-53 °C(lit.) |
| alpha | 21 º (C=10 IN H2O) |
| Boiling point: | 281.9±23.0 °C(Predicted) |
| Density | 1.161±0.06 g/cm3(Predicted) |
| refractive index | 20.5 ° (C=10, H2O) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 13.34±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| optical activity | [α]20/D +21.0°, c = 10 in H2O |
| InChI | InChI=1S/C3H7NO2/c1-2(5)3(4)6/h2,5H,1H3,(H2,4,6)/t2-/m1/s1 |
| InChIKey | SXQFCVDSOLSHOQ-UWTATZPHSA-N |
| SMILES | C(N)(=O)[C@H](O)C |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 24/25-45-36/37/39-26 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |



