PRODUCT Properties
| Boiling point: | 90 °C(Press: 0.2 Torr) |
| Density | 1.126±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Methanol |
| form | Oil |
| pka | 4.67±0.20(Predicted) |
| color | Colorless |
| optical activity | 127.898°(C=1g/100ml CHCL3) |
| InChI | InChI=1S/C7H10O2/c8-7(9)6-4-2-1-3-5-6/h1-2,6H,3-5H2,(H,8,9)/t6-/m0/s1 |
| InChIKey | VUSWCWPCANWBFG-LURJTMIESA-N |
| SMILES | [C@@H]1(C(O)=O)CCC=CC1 |
| CAS DataBase Reference | 5709-98-8 |
Description and Uses
An intermediate of Leustroducsin B (LSN-B), a novel colony-stimulating factor (CSF) inducer, which was isolated from Streptomyces platensis.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H312-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P312-P390-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN3265 |
| HazardClass | 8 |
| HS Code | 2916200090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
