A7192012
(R)-(-)-3-Carbamoymethyl-5-methylhexanoic acid , 95% , 181289-33-8
CAS NO.：181289-33-8
Empirical Formula: C9H17NO3
Molecular Weight: 187.24
MDL number: MFCD09028111
EINECS: 605-923-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB33.60 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB270.40 | In Stock |
|
| 500g | RMB1058.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-133°C |
| Boiling point: | 401.9±28.0 °C(Predicted) |
| Density | 1.080±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.68±0.10(Predicted) |
| color | White to Off-White |
| optical activity | -6.5461°(C=1.0048g/100ml DMF) |
| InChI | InChI=1S/C9H17NO3/c1-6(2)3-7(4-8(10)11)5-9(12)13/h6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13)/t7-/m1/s1 |
| InChIKey | NPDKTSLVWGFPQG-SSDOTTSWSA-N |
| SMILES | C(O)(=O)C[C@@H](CC(N)=O)CC(C)C |
| CAS DataBase Reference | 181289-33-8(CAS DataBase Reference) |
Description and Uses
An Impurity of the anti-convulsant (S)-Pregabalin (P704790).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
