M4179853
PregabalinimpurityB , EPReferenceStandard , 148553-51-9
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2005.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 274.0±23.0 °C(Predicted) |
| Density | 0.997±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 4.23±0.10(Predicted) |
| color | White |
| Major Application | pharmaceutical |
| InChI | 1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | AYXYPKUFHZROOJ-SSDOTTSWSA-N |
| SMILES | [N+H3]C[C@H](CC(C)C)CC(=O)[O-] |
Description and Uses
(R)-Pregabalin is a GABA analogue used as an anticonvulsant, Anxiolytic analgesic used to treat peripheral neuropathic pain and fibromyalgia (less potent than the S-Enantiomer).
Safety
| Symbol(GHS) |   GHS08,GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H361 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P280-P305+P351+P338-P310 |
| target organs | Central nervous system |
| WGK Germany | WGK 3 |
| HS Code | 2922493800 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 STOT SE 3 |
