BD8624955
(S)-4-Isobutylpyrrolidin-2-one , 97% , 181289-23-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB412.00 | In Stock |
|
| 250mg | RMB621.60 | In Stock |
|
| 1g | RMB1560.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 269.1±9.0 °C(Predicted) |
| Density | 0.927±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated) |
| pka | 16.66±0.40(Predicted) |
| form | Low-Melting Solid |
| color | White to Off-White |
| optical activity | Consistent with structure |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H15NO/c1-6(2)3-7-4-8(10)9-5-7/h6-7H,3-5H2,1-2H3,(H,9,10)/t7-/m0/s1 |
| InChIKey | GUGXRXLTTHFKHC-ZETCQYMHSA-N |
| SMILES | N1C[C@@H](CC(C)C)CC1=O |
Description and Uses
(S)-Pregabalin Lactam is an impurity of (S)-Pregabalin (P704790) which is a GABA analogue used as an anticonvulsant.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
