A7195812
Rifamycin sodium salt , 98% , 14897-39-3
Synonym(s):
Rifamycin SV sodium salt
CAS NO.:14897-39-3
Empirical Formula: C37H48NNaO12
Molecular Weight: 721.78
MDL number: MFCD00056847
EINECS: 238-965-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB130.40 | In Stock |
|
| 25G | RMB429.60 | In Stock |
|
| 100g | RMB1555.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >215°C (dec.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | ethanol: soluble50mg/mL |
| form | powder |
| color | Dark Red |
| Water Solubility | Soluble in water, alcohol and dimethyl sulfoxide. |
| Merck | 13,8302 |
| InChIKey | DJAAUWJRMPPGDA-HSBICLRHNA-N |
| SMILES | [Na+].CO[C@H]1\C=C\O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(NC(=O)C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)cc([O-])c4c3C2=O |
Description and Uses
Semi-synthetic antibiotic derived from Rifamycin S. Antibacterial. Potency >900 units (dry basis).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | KD1922500 |
| F | 8-10-23 |
| Storage Class | 11 - Combustible Solids |




![(2S,12Z,14E,16S,17S,18R,19R,20R,21S,22R,23S,24E)-21-(Acetyloxy)-5,6,9,17,19-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-2,7-(epoxypentadeca[1,11,13]trienimino)naphtho[2,1-b]furan-1,11(2H)-dione](https://img.chemicalbook.com/CAS/GIF/6998-60-3.gif)


