M7456748
Rifamycino , 97% , 14487-05-9
CAS NO.:14487-05-9
Empirical Formula: C39H47NO14
Molecular Weight: 753.79
MDL number: MFCD01683928
EINECS: 238-493-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB166.40 | In Stock |
|
| 25g | RMB612.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171°C (dec.) |
| alpha | D20 +71.5° (c = 1 in dioxane) |
| Boiling point: | 730.16°C (rough estimate) |
| Density | 1.2421 (rough estimate) |
| refractive index | 1.5350 (estimate) |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated ) |
| form | Solid |
| pka | 4.61±0.70(Predicted) |
| color | Yellow to Dark Yellow |
| Major Application | pharmaceutical small molecule |
| InChIKey | RAFHKEAPVIWLJC-QZBGMZITNA-N |
| SMILES | N1C2=CC5(OCC(=O)O5)c3c4c(c(c(c3C2=O)O)C)OC(O\C=C/C(C(C(C(C(C(C(C(\C=C/C=C(\C1=O)/C)C)O)C)O)C)OC(=O)C)C)OC)(C4=O)C |
Description and Uses
Rifamycin O (Rifaximin EP Impurity F) is a Rifaximin intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H371-H410 |
| Precautionary statements | P273-P391-P501-P260-P264-P270-P309+P311-P405-P501 |
| target organs | Liver |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 STOT SE 2 |





![(2S,12Z,14E,16S,17S,18R,19R,20R,21S,22R,23S,24E)-21-(Acetyloxy)-5,6,9,17,19-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-2,7-(epoxypentadeca[1,11,13]trienimino)naphtho[2,1-b]furan-1,11(2H)-dione](https://img.chemicalbook.com/CAS/GIF/6998-60-3.gif)


