A7208712
(R)-Tetrahydrofuran-3-carboxylic acid , 97% , 66838-42-4
Synonym(s):
(R)-Tetrahydro-3-furancarboxylic acid
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB119.20 | In Stock |
|
| 25MG | RMB325.60 | In Stock |
|
| 100MG | RMB782.40 | In Stock |
|
| 500mg | RMB2511.20 | In Stock |
|
| 1g | RMB3296.80 | In Stock |
|
| 5g | RMB10165.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 252.1±33.0 °C(Predicted) |
| Density | 1.262±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| pka | 4.33±0.20(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| BRN | 1281202 |
| InChI | InChI=1S/C5H8O3/c6-5(7)4-1-2-8-3-4/h4H,1-3H2,(H,6,7)/t4-/m1/s1 |
| InChIKey | BOTREHHXSQGWTR-SCSAIBSYSA-N |
| SMILES | O1CC[C@@H](C(O)=O)C1 |
| CAS DataBase Reference | 66838-42-4 |
Description and Uses
(R)-Tetrahydrofuran-3-carboxylic Acid is used in preparation of the zeste enhancer homolog 2 inhibitor and their medical applications.







